2-Chloro-6-iodopyridine
Catalog No: FT-0657287
CAS No: 258506-66-0
- Chemical Name: 2-Chloro-6-iodopyridine
- Molecular Formula: C5H3ClIN
- Molecular Weight: 239.44
- InChI Key: LSAOLINSZGYDOV-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3ClIN/c6-4-2-1-3-5(7)8-4/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 239.441 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 258506-66-0 |
| Bolling_Point: | 255.5±20.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-iodopyridine |
| Melting_Point: | 42-43ºC(lit.) |
| Flash_Point: | 108.3±21.8 °C |
| MF: | C5H3ClIN |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 2.04 |
| Flash_Point: | 108.3±21.8 °C |
| Melting_Point: | 42-43ºC(lit.) |
| FW: | 239.441 |
| PSA: | 12.89000 |
| Exact_Mass: | 238.899857 |
| MF: | C5H3ClIN |
| Bolling_Point: | 255.5±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.642 |
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)